Target identification | FUS

Algorithm | Help

The understanding of a chemical component’s mechanism of action and side effects, as well as drug discovery and systems biology, depend on the prediction of compound-target interaction. So, this web tool publishes some newly developed target-centric models employing different types of molecular descriptions and machine learning algorithms. Additionally, a consensus strategy based on these models is also published as a potential advancement above individual forecasts.

e.g. CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C4[C@@H]5CC(C)(C)CC[C@@]5(CC[C@@]34C)C(=O)OCc6ccccc6)[C@]1(C)C=O